C21H38N2 — CID 166864374
(3E,5E)-3-N-(2-ethyl-2-methylbutyl)-6-N-(3-methylpentan-3-yl)octa-1,3,5,7-tetraene-3,6-diamine (PubChem CID 166864374) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (3E,5E)-3-N-(2-ethyl-2-methylbutyl)-6-N-(3-methylpentan-3-yl)octa-1,3,5,7-tetraene-3,6-diamine.
| Compound Name | (3E,5E)-3-N-(2-ethyl-2-methylbutyl)-6-N-(3-methylpentan-3-yl)octa-1,3,5,7-tetraene-3,6-diamine |
|---|---|
| PubChem CID | 166864374 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (3E,5E)-3-N-(2-ethyl-2-methylbutyl)-6-N-(3-methylpentan-3-yl)octa-1,3,5,7-tetraene-3,6-diamine |
| SMILES | C=C/C(=C\C=C(/C=C)NC(C)(CC)CC)NCC(C)(CC)CC |
| InChI | InChI=1S/C21H38N2/c1-9-18(22-17-20(7,11-3)12-4)15-16-19(10-2)23-21(8,13-5)14-6/h9-10,15-16,22-23H,1-2,11-14,17H2,3-8H3/b18-15+,19-16+ |
| InChIKey | ICRGKNHTWUNDSF-GTLAIDDRSA-N |
| XLogP | 5.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|