C12H19NO — CID 155283556
(3E,5E)-N-ethyl-6-(methoxymethyl)octa-1,3,5,7-tetraen-3-amine (PubChem CID 155283556) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E,5E)-N-ethyl-6-(methoxymethyl)octa-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E)-N-ethyl-6-(methoxymethyl)octa-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 155283556 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3E,5E)-N-ethyl-6-(methoxymethyl)octa-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C(=C\C=C(/C=C)NCC)COC |
| InChI | InChI=1S/C12H19NO/c1-5-11(10-14-4)8-9-12(6-2)13-7-3/h5-6,8-9,13H,1-2,7,10H2,3-4H3/b11-8+,12-9+ |
| InChIKey | PBDRGYFKWJEXBL-HZOWPXDZSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|