C30H40F3N3O5S — CID 166864390
3-[methyl-[2-[6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydroquinoxalin-1-yl]ethyl]amino]propane-1,2-diol (PubChem CID 166864390) has the molecular formula C30H40F3N3O5S and a molecular weight of 611.73 g/mol. Its IUPAC name is 3-[methyl-[2-[6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydroquinoxalin-1-yl]ethyl]amino]propane-1,2-diol.
| Compound Name | 3-[methyl-[2-[6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydroquinoxalin-1-yl]ethyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 166864390 |
| Molecular Formula | C30H40F3N3O5S |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 3-[methyl-[2-[6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydroquinoxalin-1-yl]ethyl]amino]propane-1,2-diol |
| SMILES | CN(CCN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2cc(C3=CC(C)(C)OC(C)(C)C3)ccc21)CC(O)CO |
| InChI | InChI=1S/C30H40F3N3O5S/c1-28(2)17-22(18-29(3,4)41-28)21-9-10-26-27(15-21)36(14-13-35(26)12-11-34(5)19-24(38)20-37)42(39,40)25-8-6-7-23(16-25)30(31,32)33/h6-10,15-17,24,37-38H,11-14,18-20H2,1-5H3 |
| InChIKey | UAVOPLLDSPEOSN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|