C30H39N3O4S — CID 163827085
(4aS)-6-(3-methylphenyl)sulfonyl-3-(oxetan-3-yl)-8-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline (PubChem CID 163827085) has the molecular formula C30H39N3O4S and a molecular weight of 537.73 g/mol. Its IUPAC name is (4aS)-6-(3-methylphenyl)sulfonyl-3-(oxetan-3-yl)-8-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline.
| Compound Name | (4aS)-6-(3-methylphenyl)sulfonyl-3-(oxetan-3-yl)-8-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 163827085 |
| Molecular Formula | C30H39N3O4S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (4aS)-6-(3-methylphenyl)sulfonyl-3-(oxetan-3-yl)-8-(2,2,6,6-tetramethyl-3H-pyran-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline |
| SMILES | Cc1cccc(S(=O)(=O)N2C[C@@H]3CN(C4COC4)CCN3c3ccc(C4=CC(C)(C)OC(C)(C)C4)cc32)c1 |
| InChI | InChI=1S/C30H39N3O4S/c1-21-7-6-8-26(13-21)38(34,35)33-18-24-17-31(25-19-36-20-25)11-12-32(24)27-10-9-22(14-28(27)33)23-15-29(2,3)37-30(4,5)16-23/h6-10,13-15,24-25H,11-12,16-20H2,1-5H3/t24-/m0/s1 |
| InChIKey | XVCVMSWSQGZRLT-DEOSSOPVSA-N |
| XLogP | 4.45 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|