C12H14Cl2N2O3 — CID 166870743
4,6-dichloro-2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 166870743) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 4,6-dichloro-2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 4,6-dichloro-2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166870743 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4,6-dichloro-2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | CN1CCC[C@@H]1COc1nc(Cl)cc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-16-4-2-3-7(16)6-19-11-10(12(17)18)8(13)5-9(14)15-11/h5,7H,2-4,6H2,1H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | IOFPCAWSKFSASO-SSDOTTSWSA-N |
| XLogP | 2.56 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|