C12H16ClN3O3 — CID 178104654
methyl 4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carboxylate (PubChem CID 178104654) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is methyl 4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 178104654 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | methyl 4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)cc(OCC2CCCN2C)n1 |
| InChI | InChI=1S/C12H16ClN3O3/c1-16-5-3-4-8(16)7-19-10-6-9(13)14-11(15-10)12(17)18-2/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | BNJGPSKCQLFXGZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |