C11H14ClN3O5 — CID 21309714
3-chloro-6-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridazine;oxalic acid (PubChem CID 21309714) has the molecular formula C11H14ClN3O5 and a molecular weight of 303.70 g/mol. Its IUPAC name is 3-chloro-6-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridazine;oxalic acid.
| Compound Name | 3-chloro-6-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridazine;oxalic acid |
|---|---|
| PubChem CID | 21309714 |
| Molecular Formula | C11H14ClN3O5 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-chloro-6-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridazine;oxalic acid |
| SMILES | CN1CC[C@H]1COc1ccc(Cl)nn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H12ClN3O.C2H2O4/c1-13-5-4-7(13)6-14-9-3-2-8(10)11-12-9;3-1(4)2(5)6/h2-3,7H,4-6H2,1H3;(H,3,4)(H,5,6)/t7-;/m0./s1 |
| InChIKey | BSIGOBQQMJSNRX-FJXQXJEOSA-N |
| XLogP | 0.37 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|