C25H37ClN4O4 — CID 168910752
acetylene;(2R)-2-[(Z)-1-amino-2-[4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carbonyl]pent-1-enyl]cyclohexan-1-one;methanol (PubChem CID 168910752) has the molecular formula C25H37ClN4O4 and a molecular weight of 493.05 g/mol. Its IUPAC name is acetylene;(2R)-2-[(Z)-1-amino-2-[4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carbonyl]pent-1-enyl]cyclohexan-1-one;methanol.
| Compound Name | acetylene;(2R)-2-[(Z)-1-amino-2-[4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carbonyl]pent-1-enyl]cyclohexan-1-one;methanol |
|---|---|
| PubChem CID | 168910752 |
| Molecular Formula | C25H37ClN4O4 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | acetylene;(2R)-2-[(Z)-1-amino-2-[4-chloro-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidine-2-carbonyl]pent-1-enyl]cyclohexan-1-one;methanol |
| SMILES | C#C.CCC/C(C(=O)c1nc(Cl)cc(OCC2CCCN2C)n1)=C(/N)[C@H]1CCCCC1=O.CO |
| InChI | InChI=1S/C22H31ClN4O3.C2H2.CH4O/c1-3-7-16(20(24)15-9-4-5-10-17(15)28)21(29)22-25-18(23)12-19(26-22)30-13-14-8-6-11-27(14)2;2*1-2/h12,14-15H,3-11,13,24H2,1-2H3;1-2H;2H,1H3/b20-16-;;/t14?,15-;;/m0../s1 |
| InChIKey | GYHKHVVVDNDMKK-UYEKMTKTSA-N |
| XLogP | 3.42 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|