C16H19N3O4 — CID 168910640
methyl 4-(furan-3-yl)-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidine-2-carboxylate (PubChem CID 168910640) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is methyl 4-(furan-3-yl)-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-(furan-3-yl)-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 168910640 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 4-(furan-3-yl)-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(OC[C@@H]2CCCN2C)cc(-c2ccoc2)n1 |
| InChI | InChI=1S/C16H19N3O4/c1-19-6-3-4-12(19)10-23-14-8-13(11-5-7-22-9-11)17-15(18-14)16(20)21-2/h5,7-9,12H,3-4,6,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | SWGGEFCJWPBRSA-LBPRGKRZSA-N |
| XLogP | 2.00 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |