C17H30N2O6 — CID 166871035
tert-butyl N-[3-[(E)-1-aminooxybut-1-enyl]-1,5,9-trioxaspiro[5.5]undecan-3-yl]carbamate (PubChem CID 166871035) has the molecular formula C17H30N2O6 and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl N-[3-[(E)-1-aminooxybut-1-enyl]-1,5,9-trioxaspiro[5.5]undecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[(E)-1-aminooxybut-1-enyl]-1,5,9-trioxaspiro[5.5]undecan-3-yl]carbamate |
|---|---|
| PubChem CID | 166871035 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl N-[3-[(E)-1-aminooxybut-1-enyl]-1,5,9-trioxaspiro[5.5]undecan-3-yl]carbamate |
| SMILES | CC/C=C(/ON)C1(NC(=O)OC(C)(C)C)COC2(CCOCC2)OC1 |
| InChI | InChI=1S/C17H30N2O6/c1-5-6-13(25-18)16(19-14(20)24-15(2,3)4)11-22-17(23-12-16)7-9-21-10-8-17/h6H,5,7-12,18H2,1-4H3,(H,19,20)/b13-6+ |
| InChIKey | CJICWGCFXBUBFO-AWNIVKPZSA-N |
| XLogP | 1.99 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|