C24H27N7O2 — CID 166874837
N-[(3-methyl-2-pyridinyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-5-ylmethylamino)benzamide (PubChem CID 166874837) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[(3-methyl-2-pyridinyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-5-ylmethylamino)benzamide.
| Compound Name | N-[(3-methyl-2-pyridinyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-5-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 166874837 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-[(3-methyl-2-pyridinyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-5-ylmethylamino)benzamide |
| SMILES | Cc1cccnc1CNC(=O)c1cccc(NCC2NNC3c4ccncc4OCCN23)c1 |
| InChI | InChI=1S/C24H27N7O2/c1-16-4-3-8-26-20(16)13-28-24(32)17-5-2-6-18(12-17)27-15-22-29-30-23-19-7-9-25-14-21(19)33-11-10-31(22)23/h2-9,12,14,22-23,27,29-30H,10-11,13,15H2,1H3,(H,28,32) |
| InChIKey | VAFLIPUNKNGFCJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |