C26H26N6O3 — CID 162366267
N-[(2-ethoxyphenyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-ylmethylamino)benzamide (PubChem CID 162366267) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-ylmethylamino)benzamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 162366267 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-ylmethylamino)benzamide |
| SMILES | CCOc1ccccc1CNC(=O)c1cccc(NCc2nnc3n2CCOc2cnccc2-3)c1 |
| InChI | InChI=1S/C26H26N6O3/c1-2-34-22-9-4-3-6-19(22)15-29-26(33)18-7-5-8-20(14-18)28-17-24-30-31-25-21-10-11-27-16-23(21)35-13-12-32(24)25/h3-11,14,16,28H,2,12-13,15,17H2,1H3,(H,29,33) |
| InChIKey | LARIMGQSQPAATF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |