C39H36NO4Sb — CID 16687607
(tetraphenyl-lambda5-stibanyl) (1S,2R,3S,4R)-3-[(3-methylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 16687607) has the molecular formula C39H36NO4Sb and a molecular weight of 704.48 g/mol. Its IUPAC name is (tetraphenyl-lambda5-stibanyl) (1S,2R,3S,4R)-3-[(3-methylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (tetraphenyl-lambda5-stibanyl) (1S,2R,3S,4R)-3-[(3-methylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 16687607 |
| Molecular Formula | C39H36NO4Sb |
| Molecular Weight | 704.48 g/mol |
| Exact Mass | 703.17 |
| IUPAC Name | (tetraphenyl-lambda5-stibanyl) (1S,2R,3S,4R)-3-[(3-methylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | Cc1cccc(NC(=O)[C@H]2[C@@H](C(=O)O[Sb](c3ccccc3)(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]3CC[C@H]2O3)c1 |
| InChI | InChI=1S/C15H17NO4.4C6H5.Sb/c1-8-3-2-4-9(7-8)16-14(17)12-10-5-6-11(20-10)13(12)15(18)19;4*1-2-4-6-5-3-1;/h2-4,7,10-13H,5-6H2,1H3,(H,16,17)(H,18,19);4*1-5H;/q;;;;;+1/p-1/t10-,11+,12-,13+;;;;;/m1...../s1 |
| InChIKey | KAFAYMCHUIWMGF-WFGFJUDGSA-M |
| XLogP | 4.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|