About tetrahexylalumanuide
tetrahexylalumanuide (PubChem CID 16687628) has the molecular formula C24H52Al-
and a molecular weight of 367.66 g/mol. Its IUPAC name is tetrahexylalumanuide.
Molecular Properties
| Compound Name | tetrahexylalumanuide |
| PubChem CID | 16687628 |
| Molecular Formula | C24H52Al- |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.39 |
| IUPAC Name | tetrahexylalumanuide |
| SMILES | CCCCCC[Al-](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/4C6H13.Al/c4*1-3-5-6-4-2;/h4*1,3-6H2,2H3;/q;;;;-1 |
| InChIKey | ROFNBXKWBGYHTG-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetrahexylalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrahexylalumanuide?
The IUPAC name of tetrahexylalumanuide (CID 16687628) is tetrahexylalumanuide.
What is the SMILES notation for tetrahexylalumanuide?
The canonical SMILES for tetrahexylalumanuide is CCCCCC[Al-](CCCCCC)(CCCCCC)CCCCCC.
What is the InChIKey of tetrahexylalumanuide?
The InChIKey is ROFNBXKWBGYHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H13.Al/c4*1-3-5-6-4-2;/h4*1,3-6H2,2H3;/q;;;;-1.
What are the key properties of tetrahexylalumanuide?
tetrahexylalumanuide has a molecular weight of 367.66 g/mol, XLogP of 9.76, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrahexylalumanuide is sourced from PubChem (CID 16687628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).