About lithium tetrabutylalumanuide
lithium tetrabutylalumanuide (PubChem CID 16693939) has the molecular formula C16H36AlLi
and a molecular weight of 262.39 g/mol. Its IUPAC name is lithium tetrabutylalumanuide.
Molecular Properties
| Compound Name | lithium tetrabutylalumanuide |
| PubChem CID | 16693939 |
| Molecular Formula | C16H36AlLi |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.28 |
| IUPAC Name | lithium tetrabutylalumanuide |
| SMILES | CCCC[Al-](CCCC)(CCCC)CCCC.[Li+] |
| InChI | InChI=1S/4C4H9.Al.Li/c4*1-3-4-2;;/h4*1,3-4H2,2H3;;/q;;;;-1;+1 |
| InChIKey | HZCHVVWPXFHMPH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium tetrabutylalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tetrabutylalumanuide?
The IUPAC name of lithium tetrabutylalumanuide (CID 16693939) is lithium tetrabutylalumanuide.
What is the SMILES notation for lithium tetrabutylalumanuide?
The canonical SMILES for lithium tetrabutylalumanuide is CCCC[Al-](CCCC)(CCCC)CCCC.[Li+].
What is the InChIKey of lithium tetrabutylalumanuide?
The InChIKey is HZCHVVWPXFHMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/4C4H9.Al.Li/c4*1-3-4-2;;/h4*1,3-4H2,2H3;;/q;;;;-1;+1.
What are the key properties of lithium tetrabutylalumanuide?
lithium tetrabutylalumanuide has a molecular weight of 262.39 g/mol, XLogP of 3.64, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tetrabutylalumanuide is sourced from PubChem (CID 16693939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).