About lithium tetrapropylalumanuide
lithium tetrapropylalumanuide (PubChem CID 18764127) has the molecular formula C12H28AlLi
and a molecular weight of 206.28 g/mol. Its IUPAC name is lithium tetrapropylalumanuide.
Molecular Properties
| Compound Name | lithium tetrapropylalumanuide |
| PubChem CID | 18764127 |
| Molecular Formula | C12H28AlLi |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.22 |
| IUPAC Name | lithium tetrapropylalumanuide |
| SMILES | CCC[Al-](CCC)(CCC)CCC.[Li+] |
| InChI | InChI=1S/4C3H7.Al.Li/c4*1-3-2;;/h4*1,3H2,2H3;;/q;;;;-1;+1 |
| InChIKey | CAPSALSUEZFJTE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium tetrapropylalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tetrapropylalumanuide?
The IUPAC name of lithium tetrapropylalumanuide (CID 18764127) is lithium tetrapropylalumanuide.
What is the SMILES notation for lithium tetrapropylalumanuide?
The canonical SMILES for lithium tetrapropylalumanuide is CCC[Al-](CCC)(CCC)CCC.[Li+].
What is the InChIKey of lithium tetrapropylalumanuide?
The InChIKey is CAPSALSUEZFJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/4C3H7.Al.Li/c4*1-3-2;;/h4*1,3H2,2H3;;/q;;;;-1;+1.
What are the key properties of lithium tetrapropylalumanuide?
lithium tetrapropylalumanuide has a molecular weight of 206.28 g/mol, XLogP of 2.08, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tetrapropylalumanuide is sourced from PubChem (CID 18764127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).