C33H45N5O2 — CID 166881413
3'-methyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]-1-propan-2-ylspiro[piperidine-4,1'-pyrrolo[2,3-c]quinoline]-2'-one (PubChem CID 166881413) has the molecular formula C33H45N5O2 and a molecular weight of 543.76 g/mol. Its IUPAC name is 3'-methyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]-1-propan-2-ylspiro[piperidine-4,1'-pyrrolo[2,3-c]quinoline]-2'-one.
| Compound Name | 3'-methyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]-1-propan-2-ylspiro[piperidine-4,1'-pyrrolo[2,3-c]quinoline]-2'-one |
|---|---|
| PubChem CID | 166881413 |
| Molecular Formula | C33H45N5O2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 3'-methyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]-1-propan-2-ylspiro[piperidine-4,1'-pyrrolo[2,3-c]quinoline]-2'-one |
| SMILES | C=N/C(=C\C=C(/C)c1ccc2ncc3c(c2c1)C1(CCN(C(C)C)CC1)C(=O)N3C)OCCCN1CCCCC1 |
| InChI | InChI=1S/C33H45N5O2/c1-24(2)38-19-14-33(15-20-38)31-27-22-26(11-12-28(27)35-23-29(31)36(5)32(33)39)25(3)10-13-30(34-4)40-21-9-18-37-16-7-6-8-17-37/h10-13,22-24H,4,6-9,14-21H2,1-3,5H3/b25-10+,30-13+ |
| InChIKey | LCGJWPLGJSVROV-SVDIYFBMSA-N |
| XLogP | 5.79 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|