C32H40N4O3 — CID 166956244
3'-cyclopropyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]spiro[oxane-4,1'-pyrrolo[2,3-c]quinoline]-2'-one (PubChem CID 166956244) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is 3'-cyclopropyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]spiro[oxane-4,1'-pyrrolo[2,3-c]quinoline]-2'-one.
| Compound Name | 3'-cyclopropyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]spiro[oxane-4,1'-pyrrolo[2,3-c]quinoline]-2'-one |
|---|---|
| PubChem CID | 166956244 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 3'-cyclopropyl-8'-[(2E,4E)-5-(methylideneamino)-5-(3-piperidin-1-ylpropoxy)penta-2,4-dien-2-yl]spiro[oxane-4,1'-pyrrolo[2,3-c]quinoline]-2'-one |
| SMILES | C=N/C(=C\C=C(/C)c1ccc2ncc3c(c2c1)C1(CCOCC1)C(=O)N3C1CC1)OCCCN1CCCCC1 |
| InChI | InChI=1S/C32H40N4O3/c1-23(7-12-29(33-2)39-18-6-17-35-15-4-3-5-16-35)24-8-11-27-26(21-24)30-28(22-34-27)36(25-9-10-25)31(37)32(30)13-19-38-20-14-32/h7-8,11-12,21-22,25H,2-6,9-10,13-20H2,1H3/b23-7+,29-12+ |
| InChIKey | UBRBNJBBZPZCHF-XAAZGSJRSA-N |
| XLogP | 5.63 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|