C34H48FN3O3 — CID 144956335
N-[7-fluoro-4-methyl-6-[(3E,5E)-6-(3-piperidin-1-ylpropoxy)hepta-1,3,5-trien-3-yl]quinolin-3-yl]-N-methylacetamide;4-methyloxane (PubChem CID 144956335) has the molecular formula C34H48FN3O3 and a molecular weight of 565.77 g/mol. Its IUPAC name is N-[7-fluoro-4-methyl-6-[(3E,5E)-6-(3-piperidin-1-ylpropoxy)hepta-1,3,5-trien-3-yl]quinolin-3-yl]-N-methylacetamide;4-methyloxane.
| Compound Name | N-[7-fluoro-4-methyl-6-[(3E,5E)-6-(3-piperidin-1-ylpropoxy)hepta-1,3,5-trien-3-yl]quinolin-3-yl]-N-methylacetamide;4-methyloxane |
|---|---|
| PubChem CID | 144956335 |
| Molecular Formula | C34H48FN3O3 |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | N-[7-fluoro-4-methyl-6-[(3E,5E)-6-(3-piperidin-1-ylpropoxy)hepta-1,3,5-trien-3-yl]quinolin-3-yl]-N-methylacetamide;4-methyloxane |
| SMILES | C=C/C(=C\C=C(/C)OCCCN1CCCCC1)c1cc2c(C)c(N(C)C(C)=O)cnc2cc1F.CC1CCOCC1 |
| InChI | InChI=1S/C28H36FN3O2.C6H12O/c1-6-23(12-11-20(2)34-16-10-15-32-13-8-7-9-14-32)25-17-24-21(3)28(31(5)22(4)33)19-30-27(24)18-26(25)29;1-6-2-4-7-5-3-6/h6,11-12,17-19H,1,7-10,13-16H2,2-5H3;6H,2-5H2,1H3/b20-11+,23-12+; |
| InChIKey | HXBAUEDXRPCZBN-BHMZCNRJSA-N |
| XLogP | 7.46 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|