C20H29N3O4 — CID 90922855
N-[N-(oxane-4-carbonyl)-4-(3-pyrrolidin-1-ylpropoxy)anilino]formamide (PubChem CID 90922855) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[N-(oxane-4-carbonyl)-4-(3-pyrrolidin-1-ylpropoxy)anilino]formamide.
| Compound Name | N-[N-(oxane-4-carbonyl)-4-(3-pyrrolidin-1-ylpropoxy)anilino]formamide |
|---|---|
| PubChem CID | 90922855 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[N-(oxane-4-carbonyl)-4-(3-pyrrolidin-1-ylpropoxy)anilino]formamide |
| SMILES | O=CNN(C(=O)C1CCOCC1)c1ccc(OCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O4/c24-16-21-23(20(25)17-8-14-26-15-9-17)18-4-6-19(7-5-18)27-13-3-12-22-10-1-2-11-22/h4-7,16-17H,1-3,8-15H2,(H,21,24) |
| InChIKey | TZODQBSITJZEIY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|