C25H26ClFN4O4 — CID 155545153
N-(5-chloro-2-fluorophenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide (PubChem CID 155545153) has the molecular formula C25H26ClFN4O4 and a molecular weight of 500.96 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155545153 |
| Molecular Formula | C25H26ClFN4O4 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1cc(Cl)ccc1F)c1ncnc2cc(OC)c(OCCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C25H26ClFN4O4/c1-3-24(32)31(21-13-17(26)5-6-19(21)27)25-18-14-23(22(33-2)15-20(18)28-16-29-25)35-10-4-7-30-8-11-34-12-9-30/h3,5-6,13-16H,1,4,7-12H2,2H3 |
| InChIKey | QXJICNMDJLWEDC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|