C26H29FN4O4 — CID 155520384
N-(4-fluoro-3-methylphenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide (PubChem CID 155520384) has the molecular formula C26H29FN4O4 and a molecular weight of 480.54 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155520384 |
| Molecular Formula | C26H29FN4O4 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-N-[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(F)c(C)c1)c1ncnc2cc(OC)c(OCCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C26H29FN4O4/c1-4-25(32)31(19-6-7-21(27)18(2)14-19)26-20-15-24(23(33-3)16-22(20)28-17-29-26)35-11-5-8-30-9-12-34-13-10-30/h4,6-7,14-17H,1,5,8-13H2,2-3H3 |
| InChIKey | VCDFCELHISCHEY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|