C12H30Al2N2 — CID 16688366
1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane) (PubChem CID 16688366) has the molecular formula C12H30Al2N2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane).
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane) |
|---|---|
| PubChem CID | 16688366 |
| Molecular Formula | C12H30Al2N2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane) |
| SMILES | C1CN2CCN1CC2.C[Al](C)C.C[Al](C)C |
| InChI | InChI=1S/C6H12N2.6CH3.2Al/c1-2-8-5-3-7(1)4-6-8;;;;;;;;/h1-6H2;6*1H3;; |
| InChIKey | WSTAITCRSVOCTK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |