C29H30N6O — CID 166885190
6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(3,3-dimethylinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 166885190) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(3,3-dimethylinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(3,3-dimethylinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166885190 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-(3,3-dimethylinden-1-yl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC1(C)C=C(c2[nH]nc3nc(N4CCC5(CC4)Cc4ccccc4[C@H]5N)[nH]c(=O)c23)c2ccccc21 |
| InChI | InChI=1S/C29H30N6O/c1-28(2)16-20(19-9-5-6-10-21(19)28)23-22-25(34-33-23)31-27(32-26(22)36)35-13-11-29(12-14-35)15-17-7-3-4-8-18(17)24(29)30/h3-10,16,24H,11-15,30H2,1-2H3,(H2,31,32,33,34,36)/t24-/m1/s1 |
| InChIKey | XEVOCFJZWAUNQA-XMMPIXPASA-N |
| XLogP | 4.21 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |