C26H36O4 — CID 166888276
butyl (13-ethyl-17-ethynyl-17-hydroxy-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate (PubChem CID 166888276) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is butyl (13-ethyl-17-ethynyl-17-hydroxy-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate.
| Compound Name | butyl (13-ethyl-17-ethynyl-17-hydroxy-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate |
|---|---|
| PubChem CID | 166888276 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | butyl (13-ethyl-17-ethynyl-17-hydroxy-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate |
| SMILES | C#CC1(O)CCC2C3CCC4=CC(OC(=O)OCCCC)=CCC4C3CCC21CC |
| InChI | InChI=1S/C26H36O4/c1-4-7-16-29-24(27)30-19-9-11-20-18(17-19)8-10-22-21(20)12-14-25(5-2)23(22)13-15-26(25,28)6-3/h3,9,17,20-23,28H,4-5,7-8,10-16H2,1-2H3 |
| InChIKey | BNIFCWYNZGYJEH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|