C9H11BrN2O2 — CID 166889612
(6Z)-4-bromo-2-methyl-6-(5-methylidene-1,3-dioxolan-4-ylidene)-4,5-dihydro-1H-pyrimidine (PubChem CID 166889612) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is (6Z)-4-bromo-2-methyl-6-(5-methylidene-1,3-dioxolan-4-ylidene)-4,5-dihydro-1H-pyrimidine.
| Compound Name | (6Z)-4-bromo-2-methyl-6-(5-methylidene-1,3-dioxolan-4-ylidene)-4,5-dihydro-1H-pyrimidine |
|---|---|
| PubChem CID | 166889612 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (6Z)-4-bromo-2-methyl-6-(5-methylidene-1,3-dioxolan-4-ylidene)-4,5-dihydro-1H-pyrimidine |
| SMILES | C=C1OCO/C1=C1/CC(Br)N=C(C)N1 |
| InChI | InChI=1S/C9H11BrN2O2/c1-5-9(14-4-13-5)7-3-8(10)12-6(2)11-7/h8H,1,3-4H2,2H3,(H,11,12)/b9-7- |
| InChIKey | TUOIVPMFVHSZPZ-CLFYSBASSA-N |
| XLogP | 1.85 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|