C42H93NO3Sn3 — CID 16689184
2-tributylstannyloxy-N,N-bis(2-tributylstannyloxyethyl)ethanamine (PubChem CID 16689184) has the molecular formula C42H93NO3Sn3 and a molecular weight of 1016.34 g/mol. Its IUPAC name is 2-tributylstannyloxy-N,N-bis(2-tributylstannyloxyethyl)ethanamine.
| Compound Name | 2-tributylstannyloxy-N,N-bis(2-tributylstannyloxyethyl)ethanamine |
|---|---|
| PubChem CID | 16689184 |
| Molecular Formula | C42H93NO3Sn3 |
| Molecular Weight | 1016.34 g/mol |
| Exact Mass | 1019.42 |
| IUPAC Name | 2-tributylstannyloxy-N,N-bis(2-tributylstannyloxyethyl)ethanamine |
| SMILES | CCCC[Sn](CCCC)(CCCC)OCCN(CCO[Sn](CCCC)(CCCC)CCCC)CCO[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H12NO3.9C4H9.3Sn/c8-4-1-7(2-5-9)3-6-10;9*1-3-4-2;;;/h1-6H2;9*1,3-4H2,2H3;;;/q-3;;;;;;;;;;3*+1 |
| InChIKey | INVJAZBYQZJOEU-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.34 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |