C12H12Cl3NO2 — CID 166892374
1-(1-benzofuran-6-yl)-3,3,3-trichloro-2-(methylamino)propan-1-ol (PubChem CID 166892374) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 1-(1-benzofuran-6-yl)-3,3,3-trichloro-2-(methylamino)propan-1-ol.
| Compound Name | 1-(1-benzofuran-6-yl)-3,3,3-trichloro-2-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 166892374 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 1-(1-benzofuran-6-yl)-3,3,3-trichloro-2-(methylamino)propan-1-ol |
| SMILES | CNC(C(O)c1ccc2ccoc2c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3NO2/c1-16-11(12(13,14)15)10(17)8-3-2-7-4-5-18-9(7)6-8/h2-6,10-11,16-17H,1H3 |
| InChIKey | YCBBPPLCEWLSDV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|