C16H21N — CID 166892849
7,7a,8,9,10,11,12,12a-octahydrobenzo[a]heptalen-7-amine (PubChem CID 166892849) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 7,7a,8,9,10,11,12,12a-octahydrobenzo[a]heptalen-7-amine.
| Compound Name | 7,7a,8,9,10,11,12,12a-octahydrobenzo[a]heptalen-7-amine |
|---|---|
| PubChem CID | 166892849 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 7,7a,8,9,10,11,12,12a-octahydrobenzo[a]heptalen-7-amine |
| SMILES | NC1C=Cc2ccccc2C2CCCCCC12 |
| InChI | InChI=1S/C16H21N/c17-16-11-10-12-6-4-5-7-13(12)14-8-2-1-3-9-15(14)16/h4-7,10-11,14-16H,1-3,8-9,17H2 |
| InChIKey | GVHVEIUBXBJCKY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |