C20H21ClFN3O3 — CID 166896229
4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-methylidene-N-[(4-methyl-3-pyridinyl)methyl]butanamide (PubChem CID 166896229) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-methylidene-N-[(4-methyl-3-pyridinyl)methyl]butanamide.
| Compound Name | 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-methylidene-N-[(4-methyl-3-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 166896229 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-methylidene-N-[(4-methyl-3-pyridinyl)methyl]butanamide |
| SMILES | C=C(CCNC(=O)COc1ccc(Cl)c(F)c1)C(=O)NCc1cnccc1C |
| InChI | InChI=1S/C20H21ClFN3O3/c1-13-5-7-23-10-15(13)11-25-20(27)14(2)6-8-24-19(26)12-28-16-3-4-17(21)18(22)9-16/h3-5,7,9-10H,2,6,8,11-12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | GVWHENHQZUYDDI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|