C19H18Cl3N3O2 — CID 166896707
3,4-dichloro-N-[6-[(6-chloro-3-pyridinyl)amino]-5-methyl-6-oxohex-1-en-2-yl]benzamide (PubChem CID 166896707) has the molecular formula C19H18Cl3N3O2 and a molecular weight of 426.73 g/mol. Its IUPAC name is 3,4-dichloro-N-[6-[(6-chloro-3-pyridinyl)amino]-5-methyl-6-oxohex-1-en-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[6-[(6-chloro-3-pyridinyl)amino]-5-methyl-6-oxohex-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 166896707 |
| Molecular Formula | C19H18Cl3N3O2 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 3,4-dichloro-N-[6-[(6-chloro-3-pyridinyl)amino]-5-methyl-6-oxohex-1-en-2-yl]benzamide |
| SMILES | C=C(CCC(C)C(=O)Nc1ccc(Cl)nc1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl3N3O2/c1-11(18(26)25-14-6-8-17(22)23-10-14)3-4-12(2)24-19(27)13-5-7-15(20)16(21)9-13/h5-11H,2-4H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | YXYPGABQBMZDFO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|