C15H10FN7O — CID 166903288
N-[4-[2-(dicyanomethylidene)hydrazinyl]-2-fluorophenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 166903288) has the molecular formula C15H10FN7O and a molecular weight of 323.29 g/mol. Its IUPAC name is N-[4-[2-(dicyanomethylidene)hydrazinyl]-2-fluorophenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[4-[2-(dicyanomethylidene)hydrazinyl]-2-fluorophenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166903288 |
| Molecular Formula | C15H10FN7O |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[4-[2-(dicyanomethylidene)hydrazinyl]-2-fluorophenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(NN=C(C#N)C#N)cc2F)cn1 |
| InChI | InChI=1S/C15H10FN7O/c1-9-7-20-14(8-19-9)15(24)21-13-3-2-10(4-12(13)16)22-23-11(5-17)6-18/h2-4,7-8,22H,1H3,(H,21,24) |
| InChIKey | ADFPLVZXHUUCHR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|