C22H31N5O4S — CID 166904028
8-cyclopentyl-2-[[1-[(E)-4-methoxybut-1-enyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 166904028) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is 8-cyclopentyl-2-[[1-[(E)-4-methoxybut-1-enyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[[1-[(E)-4-methoxybut-1-enyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166904028 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 8-cyclopentyl-2-[[1-[(E)-4-methoxybut-1-enyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COCC/C=C/S(=O)(=O)N1CCC(Nc2ncc3ccc(=O)n(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C22H31N5O4S/c1-31-14-4-5-15-32(29,30)26-12-10-18(11-13-26)24-22-23-16-17-8-9-20(28)27(21(17)25-22)19-6-2-3-7-19/h5,8-9,15-16,18-19H,2-4,6-7,10-14H2,1H3,(H,23,24,25)/b15-5+ |
| InChIKey | QXTSTZMVMPTOAI-PJQLUOCWSA-N |
| XLogP | 2.66 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|