C23H31N5O4S — CID 166904038
8-cyclopentyl-2-[[1-[(2Z)-2-(oxolan-3-ylidene)ethyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 166904038) has the molecular formula C23H31N5O4S and a molecular weight of 473.60 g/mol. Its IUPAC name is 8-cyclopentyl-2-[[1-[(2Z)-2-(oxolan-3-ylidene)ethyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[[1-[(2Z)-2-(oxolan-3-ylidene)ethyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166904038 |
| Molecular Formula | C23H31N5O4S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 8-cyclopentyl-2-[[1-[(2Z)-2-(oxolan-3-ylidene)ethyl]sulfonylpiperidin-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NC3CCN(S(=O)(=O)C/C=C4/CCOC4)CC3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C23H31N5O4S/c29-21-6-5-18-15-24-23(26-22(18)28(21)20-3-1-2-4-20)25-19-7-11-27(12-8-19)33(30,31)14-10-17-9-13-32-16-17/h5-6,10,15,19-20H,1-4,7-9,11-14,16H2,(H,24,25,26)/b17-10- |
| InChIKey | VGEHDQBFYRGPGE-YVLHZVERSA-N |
| XLogP | 2.46 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|