C15H28O4 — CID 166905268
[(Z)-2-(4-methylpentoxy)hex-2-enoxy]methyl acetate (PubChem CID 166905268) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is [(Z)-2-(4-methylpentoxy)hex-2-enoxy]methyl acetate.
| Compound Name | [(Z)-2-(4-methylpentoxy)hex-2-enoxy]methyl acetate |
|---|---|
| PubChem CID | 166905268 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [(Z)-2-(4-methylpentoxy)hex-2-enoxy]methyl acetate |
| SMILES | CCC/C=C(/COCOC(C)=O)OCCCC(C)C |
| InChI | InChI=1S/C15H28O4/c1-5-6-9-15(11-17-12-19-14(4)16)18-10-7-8-13(2)3/h9,13H,5-8,10-12H2,1-4H3/b15-9- |
| InChIKey | NGWXDLBZUJNSNT-DHDCSXOGSA-N |
| XLogP | 3.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|