C15H21N5S — CID 166905326
2-[(Z)-1-amino-3-iminoprop-1-enyl]-7-N-pentan-3-ylthieno[3,2-b]pyridine-5,7-diamine (PubChem CID 166905326) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-[(Z)-1-amino-3-iminoprop-1-enyl]-7-N-pentan-3-ylthieno[3,2-b]pyridine-5,7-diamine.
| Compound Name | 2-[(Z)-1-amino-3-iminoprop-1-enyl]-7-N-pentan-3-ylthieno[3,2-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 166905326 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[(Z)-1-amino-3-iminoprop-1-enyl]-7-N-pentan-3-ylthieno[3,2-b]pyridine-5,7-diamine |
| SMILES | [H]/N=C/C=C(\N)c1cc2nc(N)cc(NC(CC)CC)c2s1 |
| InChI | InChI=1S/C15H21N5S/c1-3-9(4-2)19-12-8-14(18)20-11-7-13(21-15(11)12)10(17)5-6-16/h5-9,16H,3-4,17H2,1-2H3,(H3,18,19,20)/b10-5-,16-6+ |
| InChIKey | GLCFENITOQOXAS-IHGRDSKKSA-N |
| XLogP | 3.43 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|