C50H44N2 — CID 166905637
3-[3-[10-(1,7,8,8a-tetrahydronaphthalen-2-yl)-8-methyl-9-naphthalen-2-yl-8,8a-dihydroanthracen-2-yl]-1-methyl-2H-pyridin-6-yl]-7,8-dihydroquinoline (PubChem CID 166905637) has the molecular formula C50H44N2 and a molecular weight of 672.92 g/mol. Its IUPAC name is 3-[3-[10-(1,7,8,8a-tetrahydronaphthalen-2-yl)-8-methyl-9-naphthalen-2-yl-8,8a-dihydroanthracen-2-yl]-1-methyl-2H-pyridin-6-yl]-7,8-dihydroquinoline.
| Compound Name | 3-[3-[10-(1,7,8,8a-tetrahydronaphthalen-2-yl)-8-methyl-9-naphthalen-2-yl-8,8a-dihydroanthracen-2-yl]-1-methyl-2H-pyridin-6-yl]-7,8-dihydroquinoline |
|---|---|
| PubChem CID | 166905637 |
| Molecular Formula | C50H44N2 |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | 3-[3-[10-(1,7,8,8a-tetrahydronaphthalen-2-yl)-8-methyl-9-naphthalen-2-yl-8,8a-dihydroanthracen-2-yl]-1-methyl-2H-pyridin-6-yl]-7,8-dihydroquinoline |
| SMILES | CC1C=CC=C2C(C3=CC=C4C=CCCC4C3)=c3ccc(C4=CC=C(c5cnc6c(c5)C=CCC6)N(C)C4)cc3=C(c3ccc4ccccc4c3)C21 |
| InChI | InChI=1S/C50H44N2/c1-32-10-9-16-44-48(32)50(40-21-19-34-12-4-6-14-36(34)27-40)45-29-37(22-24-43(45)49(44)39-20-18-33-11-3-5-13-35(33)26-39)41-23-25-47(52(2)31-41)42-28-38-15-7-8-17-46(38)51-30-42/h3-4,6-7,9-12,14-16,18-25,27-30,32,35,48H,5,8,13,17,26,31H2,1-2H3 |
| InChIKey | NOBKTYIWCQXQDR-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |