C68H48F6N2O2 — CID 166909863
1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)naphthalen-2-yl]-5a,10c-dihydropyrene-1,6-diamine (PubChem CID 166909863) has the molecular formula C68H48F6N2O2 and a molecular weight of 1039.13 g/mol. Its IUPAC name is 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)naphthalen-2-yl]-5a,10c-dihydropyrene-1,6-diamine.
| Compound Name | 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)naphthalen-2-yl]-5a,10c-dihydropyrene-1,6-diamine |
|---|---|
| PubChem CID | 166909863 |
| Molecular Formula | C68H48F6N2O2 |
| Molecular Weight | 1039.13 g/mol |
| Exact Mass | 1038.36 |
| IUPAC Name | 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)naphthalen-2-yl]-5a,10c-dihydropyrene-1,6-diamine |
| SMILES | CC(C)C1=C2C=Cc3c(N(c4cc(C(F)(F)F)c5ccccc5c4)c4cccc5c4oc4ccccc45)cc(C(C)C)c4c3C2C(C=C4)C(N(c2cc(C(F)(F)F)c3ccccc3c2)c2cccc3c2oc2ccccc23)=C1 |
| InChI | InChI=1S/C68H48F6N2O2/c1-37(2)53-35-59(75(41-31-39-15-5-7-17-43(39)55(33-41)67(69,70)71)57-23-13-21-49-45-19-9-11-25-61(45)77-65(49)57)51-30-28-48-54(38(3)4)36-60(52-29-27-47(53)63(51)64(48)52)76(42-32-40-16-6-8-18-44(40)56(34-42)68(72,73)74)58-24-14-22-50-46-20-10-12-26-62(46)78-66(50)58/h5-38,51,63H,1-4H3 |
| InChIKey | RXDZOTNHSDHGIQ-UHFFFAOYSA-N |
| XLogP | 20.86 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.13 |
| LogP ≤ 5 | 20.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |