C31H32FN5O4S — CID 166911202
2-(5-fluoro-2-hydroxyphenyl)-2-[5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 166911202) has the molecular formula C31H32FN5O4S and a molecular weight of 589.69 g/mol. Its IUPAC name is 2-(5-fluoro-2-hydroxyphenyl)-2-[5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(5-fluoro-2-hydroxyphenyl)-2-[5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166911202 |
| Molecular Formula | C31H32FN5O4S |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 2-(5-fluoro-2-hydroxyphenyl)-2-[5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(c1cc(F)ccc1O)N1CC2=C(CC(c3ccc(N4CCN(CCO)CC4)cc3)C=C2)C1=O |
| InChI | InChI=1S/C31H32FN5O4S/c32-23-5-8-27(39)26(18-23)28(29(40)34-31-33-9-16-42-31)37-19-22-2-1-21(17-25(22)30(37)41)20-3-6-24(7-4-20)36-12-10-35(11-13-36)14-15-38/h1-9,16,18,21,28,38-39H,10-15,17,19H2,(H,33,34,40) |
| InChIKey | IBJBVAKMHJRABH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|