C31H28FN3O3S — CID 169099084
2-[5-(4-cyclohexylphenyl)-3-oxo-1H-isoindol-2-yl]-2-(5-fluoro-2-hydroxyphenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 169099084) has the molecular formula C31H28FN3O3S and a molecular weight of 541.65 g/mol. Its IUPAC name is 2-[5-(4-cyclohexylphenyl)-3-oxo-1H-isoindol-2-yl]-2-(5-fluoro-2-hydroxyphenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[5-(4-cyclohexylphenyl)-3-oxo-1H-isoindol-2-yl]-2-(5-fluoro-2-hydroxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 169099084 |
| Molecular Formula | C31H28FN3O3S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-[5-(4-cyclohexylphenyl)-3-oxo-1H-isoindol-2-yl]-2-(5-fluoro-2-hydroxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(c1cc(F)ccc1O)N1Cc2ccc(-c3ccc(C4CCCCC4)cc3)cc2C1=O |
| InChI | InChI=1S/C31H28FN3O3S/c32-24-12-13-27(36)26(17-24)28(29(37)34-31-33-14-15-39-31)35-18-23-11-10-22(16-25(23)30(35)38)21-8-6-20(7-9-21)19-4-2-1-3-5-19/h6-17,19,28,36H,1-5,18H2,(H,33,34,37) |
| InChIKey | JHAPSIRWZLTEIZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|