C28H22FN3O6S — CID 139511922
4-[2-[1-[5-fluoro-2-(methoxymethoxy)phenyl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3-oxo-1H-isoindol-5-yl]benzoic acid (PubChem CID 139511922) has the molecular formula C28H22FN3O6S and a molecular weight of 547.56 g/mol. Its IUPAC name is 4-[2-[1-[5-fluoro-2-(methoxymethoxy)phenyl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3-oxo-1H-isoindol-5-yl]benzoic acid.
| Compound Name | 4-[2-[1-[5-fluoro-2-(methoxymethoxy)phenyl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3-oxo-1H-isoindol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 139511922 |
| Molecular Formula | C28H22FN3O6S |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 4-[2-[1-[5-fluoro-2-(methoxymethoxy)phenyl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3-oxo-1H-isoindol-5-yl]benzoic acid |
| SMILES | COCOc1ccc(F)cc1C(C(=O)Nc1nccs1)N1Cc2ccc(-c3ccc(C(=O)O)cc3)cc2C1=O |
| InChI | InChI=1S/C28H22FN3O6S/c1-37-15-38-23-9-8-20(29)13-22(23)24(25(33)31-28-30-10-11-39-28)32-14-19-7-6-18(12-21(19)26(32)34)16-2-4-17(5-3-16)27(35)36/h2-13,24H,14-15H2,1H3,(H,35,36)(H,30,31,33) |
| InChIKey | RTKRBPMOJBQWRY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|