C28H29FN4O4 — CID 166950801
2-[5-fluoro-2-(methoxymethoxy)phenyl]-2-[3-oxo-5-(4-piperazin-1-ylphenyl)-1H-isoindol-2-yl]acetamide (PubChem CID 166950801) has the molecular formula C28H29FN4O4 and a molecular weight of 504.56 g/mol. Its IUPAC name is 2-[5-fluoro-2-(methoxymethoxy)phenyl]-2-[3-oxo-5-(4-piperazin-1-ylphenyl)-1H-isoindol-2-yl]acetamide.
| Compound Name | 2-[5-fluoro-2-(methoxymethoxy)phenyl]-2-[3-oxo-5-(4-piperazin-1-ylphenyl)-1H-isoindol-2-yl]acetamide |
|---|---|
| PubChem CID | 166950801 |
| Molecular Formula | C28H29FN4O4 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-[5-fluoro-2-(methoxymethoxy)phenyl]-2-[3-oxo-5-(4-piperazin-1-ylphenyl)-1H-isoindol-2-yl]acetamide |
| SMILES | COCOc1ccc(F)cc1C(C(N)=O)N1Cc2ccc(-c3ccc(N4CCNCC4)cc3)cc2C1=O |
| InChI | InChI=1S/C28H29FN4O4/c1-36-17-37-25-9-6-21(29)15-24(25)26(27(30)34)33-16-20-3-2-19(14-23(20)28(33)35)18-4-7-22(8-5-18)32-12-10-31-11-13-32/h2-9,14-15,26,31H,10-13,16-17H2,1H3,(H2,30,34) |
| InChIKey | KORZFXQEHBZQKQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|