C31H24FN5O3 — CID 164883965
6-[2-(6-amino-3-pyridinyl)ethynyl]-2-[1H-benzimidazol-2-yl-[5-fluoro-2-(methoxymethoxy)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 164883965) has the molecular formula C31H24FN5O3 and a molecular weight of 533.56 g/mol. Its IUPAC name is 6-[2-(6-amino-3-pyridinyl)ethynyl]-2-[1H-benzimidazol-2-yl-[5-fluoro-2-(methoxymethoxy)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 6-[2-(6-amino-3-pyridinyl)ethynyl]-2-[1H-benzimidazol-2-yl-[5-fluoro-2-(methoxymethoxy)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 164883965 |
| Molecular Formula | C31H24FN5O3 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 6-[2-(6-amino-3-pyridinyl)ethynyl]-2-[1H-benzimidazol-2-yl-[5-fluoro-2-(methoxymethoxy)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | COCOc1ccc(F)cc1C(c1nc2ccccc2[nH]1)N1Cc2ccc(C#Cc3ccc(N)nc3)cc2C1=O |
| InChI | InChI=1S/C31H24FN5O3/c1-39-18-40-27-12-11-22(32)15-24(27)29(30-35-25-4-2-3-5-26(25)36-30)37-17-21-10-8-19(14-23(21)31(37)38)6-7-20-9-13-28(33)34-16-20/h2-5,8-16,29H,17-18H2,1H3,(H2,33,34)(H,35,36) |
| InChIKey | AGTXJQGQMSZZPT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|