C34H30F2N4O2 — CID 166509736
2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindol-1-one (PubChem CID 166509736) has the molecular formula C34H30F2N4O2 and a molecular weight of 564.64 g/mol. Its IUPAC name is 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindol-1-one.
| Compound Name | 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 166509736 |
| Molecular Formula | C34H30F2N4O2 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindol-1-one |
| SMILES | CN1CCC(c2ccc(-c3ccc4c(c3)C(=O)N(C(c3nc5ccccc5[nH]3)c3cc(F)ccc3O)C4)cc2F)CC1 |
| InChI | InChI=1S/C34H30F2N4O2/c1-39-14-12-20(13-15-39)25-10-8-22(17-28(25)36)21-6-7-23-19-40(34(42)26(23)16-21)32(27-18-24(35)9-11-31(27)41)33-37-29-4-2-3-5-30(29)38-33/h2-11,16-18,20,32,41H,12-15,19H2,1H3,(H,37,38) |
| InChIKey | ADWTWVBIGPUESK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|