C38H38FN5O2 — CID 146380978
2-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3H-isoindol-1-one (PubChem CID 146380978) has the molecular formula C38H38FN5O2 and a molecular weight of 615.75 g/mol. Its IUPAC name is 2-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3H-isoindol-1-one.
| Compound Name | 2-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146380978 |
| Molecular Formula | C38H38FN5O2 |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3H-isoindol-1-one |
| SMILES | O=C1c2cc(-c3ccc(N4CCC(N5CCNCC5)CC4)cc3)ccc2CN1[C@@H](c1cc2ccccc2[nH]1)c1cc(F)ccc1O |
| InChI | InChI=1S/C38H38FN5O2/c39-29-9-12-36(45)33(23-29)37(35-22-27-3-1-2-4-34(27)41-35)44-24-28-6-5-26(21-32(28)38(44)46)25-7-10-30(11-8-25)42-17-13-31(14-18-42)43-19-15-40-16-20-43/h1-12,21-23,31,37,40-41,45H,13-20,24H2/t37-/m1/s1 |
| InChIKey | FUKUNJCDTJCYGP-DIPNUNPCSA-N |
| XLogP | 6.30 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|