C29H29FN4O2 — CID 146381045
2-[(R)-(5-fluoro-2-methoxyphenyl)-(1H-indol-2-yl)methyl]-6-(4-methylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 146381045) has the molecular formula C29H29FN4O2 and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-[(R)-(5-fluoro-2-methoxyphenyl)-(1H-indol-2-yl)methyl]-6-(4-methylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(R)-(5-fluoro-2-methoxyphenyl)-(1H-indol-2-yl)methyl]-6-(4-methylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146381045 |
| Molecular Formula | C29H29FN4O2 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[(R)-(5-fluoro-2-methoxyphenyl)-(1H-indol-2-yl)methyl]-6-(4-methylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | COc1ccc(F)cc1[C@H](c1cc2ccccc2[nH]1)N1Cc2ccc(N3CCN(C)CC3)cc2C1=O |
| InChI | InChI=1S/C29H29FN4O2/c1-32-11-13-33(14-12-32)22-9-7-20-18-34(29(35)23(20)17-22)28(24-16-21(30)8-10-27(24)36-2)26-15-19-5-3-4-6-25(19)31-26/h3-10,15-17,28,31H,11-14,18H2,1-2H3/t28-/m1/s1 |
| InChIKey | MUJBWKMEJTZYCR-MUUNZHRXSA-N |
| XLogP | 4.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|