C36H35ClN4O2 — CID 146380969
2-[(R)-(5-chloro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3H-isoindol-1-one (PubChem CID 146380969) has the molecular formula C36H35ClN4O2 and a molecular weight of 591.16 g/mol. Its IUPAC name is 2-[(R)-(5-chloro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3H-isoindol-1-one.
| Compound Name | 2-[(R)-(5-chloro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146380969 |
| Molecular Formula | C36H35ClN4O2 |
| Molecular Weight | 591.16 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-[(R)-(5-chloro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3H-isoindol-1-one |
| SMILES | CN(C)C1CCN(c2ccc(-c3ccc4c(c3)C(=O)N([C@@H](c3cc5ccccc5[nH]3)c3cc(Cl)ccc3O)C4)cc2)CC1 |
| InChI | InChI=1S/C36H35ClN4O2/c1-39(2)28-15-17-40(18-16-28)29-12-9-23(10-13-29)24-7-8-26-22-41(36(43)30(26)19-24)35(31-21-27(37)11-14-34(31)42)33-20-25-5-3-4-6-32(25)38-33/h3-14,19-21,28,35,38,42H,15-18,22H2,1-2H3/t35-/m1/s1 |
| InChIKey | XFZPZZXGEQCHBN-PGUFJCEWSA-N |
| XLogP | 7.47 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.16 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|