C36H37FN4O2 — CID 174228039
3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-propan-2-ylbenzamide (PubChem CID 174228039) has the molecular formula C36H37FN4O2 and a molecular weight of 576.72 g/mol. Its IUPAC name is 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-propan-2-ylbenzamide.
| Compound Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 174228039 |
| Molecular Formula | C36H37FN4O2 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1cc(C(=O)NC(c2cc3ccccc3[nH]2)c2cc(F)ccc2O)cc(-c2ccc(N3CCC(N)CC3)cc2)c1 |
| InChI | InChI=1S/C36H37FN4O2/c1-22(2)25-17-26(23-7-10-30(11-8-23)41-15-13-29(38)14-16-41)19-27(18-25)36(43)40-35(31-21-28(37)9-12-34(31)42)33-20-24-5-3-4-6-32(24)39-33/h3-12,17-22,29,35,39,42H,13-16,38H2,1-2H3,(H,40,43) |
| InChIKey | GCKMPQCWTXDBER-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|