C34H33FN4O2 — CID 166135182
3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-2-methylbenzamide (PubChem CID 166135182) has the molecular formula C34H33FN4O2 and a molecular weight of 548.66 g/mol. Its IUPAC name is 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-2-methylbenzamide.
| Compound Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 166135182 |
| Molecular Formula | C34H33FN4O2 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-2-methylbenzamide |
| SMILES | Cc1c(C(=O)N[C@@H](c2cc3ccccc3[nH]2)c2cc(F)ccc2O)cccc1-c1ccc(N2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C34H33FN4O2/c1-21-27(22-9-12-26(13-10-22)39-17-15-25(36)16-18-39)6-4-7-28(21)34(41)38-33(29-20-24(35)11-14-32(29)40)31-19-23-5-2-3-8-30(23)37-31/h2-14,19-20,25,33,37,40H,15-18,36H2,1H3,(H,38,41)/t33-/m1/s1 |
| InChIKey | XQXGBTZLFLSXLL-MGBGTMOVSA-N |
| XLogP | 6.43 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|