C34H32F2N4O2 — CID 166135174
3-[4-(4-aminopiperidin-1-yl)-2-fluorophenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-methylbenzamide (PubChem CID 166135174) has the molecular formula C34H32F2N4O2 and a molecular weight of 566.65 g/mol. Its IUPAC name is 3-[4-(4-aminopiperidin-1-yl)-2-fluorophenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-methylbenzamide.
| Compound Name | 3-[4-(4-aminopiperidin-1-yl)-2-fluorophenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 166135174 |
| Molecular Formula | C34H32F2N4O2 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 3-[4-(4-aminopiperidin-1-yl)-2-fluorophenyl]-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)N[C@@H](c2cc3ccccc3[nH]2)c2cc(F)ccc2O)cc(-c2ccc(N3CCC(N)CC3)cc2F)c1 |
| InChI | InChI=1S/C34H32F2N4O2/c1-20-14-22(27-8-7-26(19-29(27)36)40-12-10-25(37)11-13-40)16-23(15-20)34(42)39-33(28-18-24(35)6-9-32(28)41)31-17-21-4-2-3-5-30(21)38-31/h2-9,14-19,25,33,38,41H,10-13,37H2,1H3,(H,39,42)/t33-/m1/s1 |
| InChIKey | BMCKULGLVJVKIC-MGBGTMOVSA-N |
| XLogP | 6.57 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|